Giải bài tập môn Hóa Học lớp 12 Bài 4: Luyện tập este và chất béo

Đánh giá của bạn
Đánh giá của bạn

Giải bài tập môn Hóa Học lớp 12 Bài 4: Luyện tập este và chất béo

Giải bài tập môn Hóa Học lớp 12 Bài 4: Luyện tập este và chất béo – Dethithuvn.com xin giới thiệu tới các em học sinh cùng quý phụ huynh Giải bài tập môn Hóa Học lớp 12 Bài 4: Luyện tập este và chất béo để tham khảo chuẩn bị tốt cho bài giảng học kì mới sắp tới đây của mình. Mời các em tham khảo.

Giải bài tập môn Hóa Học lớp 12 Bài 4: Luyện tập este và chất béo - Giải bài tập môn Hóa Học lớp 12
Giải bài tập môn Hóa Học lớp 12 Bài 4: Luyện tập este và chất béo

Giải bài tập môn Hóa Học lớp 12 Bài 4: Luyện tập este và chất béo

Hướng dẫn giải bài tập lớp 12 Bài 4: Luyện tập este và chất béo

TRẢ LỜI CÁC CÂU HỎI

  1. So sánh chất béo và este về thành phần nguyên tố, đặc điểm cấu tạo phân tử và tính chất hóa học.

Trả lời.

Chất béo:,Este; giống nhau

Thành phần nguyên tố

 -Chứa C, H, O

Đặc điểm cấu tạo phân tử:

– Là hợp chất este

Tính chất hóa học:

-Phản ứng thủy phân trong môi trường axit

-Phản ứng xà phòng hóa

Chất béo:,Este; khác nhau:ở đặc điểm cấu tạo nguyên tử

Chất béo-Trieste của glixerol với axit béo

Este- Là este của ancol và axit

  1. Khi đun hỗn hợp 2 axit cacboxylic với glixerol ( axit H2SO4làm xúc tác ) có thể thu được mấy Trieste ? Viết công thức cấu tạo của các chất này.

Hướng dẫn.

Có thể thu được 6 trieste.

  1. Khi thủy phân (xúc tác axit) một este thu được một glixerol và hỗn hợp axit stearic (C17H35COOH) và axit panmitic (C15H31COOh) theo tỉ lệ 2 : 1.

Este có thể có công thức cấu tạo nào sau đây?

 

Hướng dẫn.

Đáp án B.

  1. Làm bay hơi 7,4 gam một este A no, đơn chức thu được một thể tích hơi bằng thể tích của 3,2 gam khí oxi ở cùng điều kiện nhiệt độ, áp suất.
  2. a) Tìm công thức phân tử của A.
  3. b) Thực hiện phản ứng xà phòng hóa 7,4 gam A với dung dịch NaOH khi đến phản ứng hoàn toàn thu được sản phẩm có 6,8 gam muối. Tìm công thức cấu tạo và tên gọi của A.

Hướng dẫn.

Vì A là este no, đơn chức nên có công thức phân tử là CH2nO2.

Ta có  (mol)

=>  MA = 74 g/mol =>14n+32 = 74 => n = 3.

=>  Công thức phân tử của A là C3H6O2.

  1. b)

nRCOONa  = 0,1 (mol) => MRCOONa = 68 g/mol =>R là H

Công thức cấu tạo của A là HCOOC2H5 (etyl fomat).

  1. Khi thủy phân a gam một este X thu được 0,92 gam glixerol, 3,02 gam natri linoleat C17H33COONa.

Tính giá trị của a, m. Viết công thức cấu tạo có thể có của X.

Hướng dẫn giải.

(mol) ;  (mol).

(mol) => m = 0,02.304 = 6,08 (gam).

X là C17H31COOC3H5(C17H33COO)2 ; nX = nglixerol = 0,01 mol

=> a = 0,01.882 = 8,82 (gam).

  1. Thủy phân hoàn toàn 8,8 gam este đơn chức, mạch hở X với 100ml dung dịch KOH 1M (vừa đủ) thu được 4,6 gam một ancol Y. Tên gọi của X là
  2. etyl fomat.
  3. etyl propionate.
  4. etyl axetat.
  5. propyl axetat.

Trả lời.

Đáp án C

  1. Đốt cháy hoàn toàn 3,7 gam một este đơn chức X thu được 3,36 lít khí CO2(đktc) và 2,7 gam nước. Công thức phân tử của X là :
  2. C2H4O2 B. C3H6O2.
  3. C4H8O2.                                         D. C5H8O2.

Hướng dẫn.

Đáp án B.

  1. 10,4 gam hỗn hợp X gồm axit axetic và etyl axetat tác dụng vừa đủ với 150 gam dung dịch Natri hiđroxit 4% . Phần trăm khối lượng của etyl axetat trong hỗn hợp bằng.
  2. 22%                                       B. 42,3%
  3. 57,7%                                    D. 88%.

Giải bài tập môn Hóa Học lớp 12 Bài 4: Luyện tập este và chất béo

Bạn đang xem bài viết Giải bài tập môn Hóa Học lớp 12 Bài 4: Luyện tập este và chất béo.
Bài viết được tổng hợp bởi website https://dethithuvn.com

Để có đầy đủ, chi tiết và đúng định dạng, bạn vui lòng tải về để xem. Đừng quên theo dõi Đề Thi Thử Việt Nam trên Facebook để nhanh chóng nhận được thông tin mới nhất hàng ngày.

Chia sẻ

Đánh giá của bạn